C13H23F6N4O3P — CID 91103603
ethyl (2Z)-2-cyano-2-[dimethylamino(piperidin-1-ium-1-yl)methoxy]iminoacetate;pentafluoro-λ5-phosphane;fluoride (PubChem CID 91103603) has the molecular formula C13H23F6N4O3P and a molecular weight of 428.31 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-[dimethylamino(piperidin-1-ium-1-yl)methoxy]iminoacetate;pentafluoro-λ5-phosphane;fluoride.
| Compound Name | ethyl (2Z)-2-cyano-2-[dimethylamino(piperidin-1-ium-1-yl)methoxy]iminoacetate;pentafluoro-λ5-phosphane;fluoride |
|---|---|
| PubChem CID | 91103603 |
| Molecular Formula | C13H23F6N4O3P |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-[dimethylamino(piperidin-1-ium-1-yl)methoxy]iminoacetate;pentafluoro-λ5-phosphane;fluoride |
| SMILES | CCOC(=O)/C(C#N)=N\OC(N(C)C)[NH+]1CCCCC1.FP(F)(F)(F)F.[F-] |
| InChI | InChI=1S/C13H22N4O3.F5P.FH/c1-4-19-12(18)11(10-14)15-20-13(16(2)3)17-8-6-5-7-9-17;1-6(2,3,4)5;/h13H,4-9H2,1-3H3;;1H/b15-11-;; |
| InChIKey | QSFGGQZAICEBMC-VGUYJMDASA-N |
| XLogP | -0.67 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|