C12H5Cl5N2O5 — CID 88839635
ethyl (2Z)-2-cyano-2-(2,3,4,5,6-pentachlorophenoxy)carbonyloxyiminoacetate (PubChem CID 88839635) has the molecular formula C12H5Cl5N2O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-(2,3,4,5,6-pentachlorophenoxy)carbonyloxyiminoacetate.
| Compound Name | ethyl (2Z)-2-cyano-2-(2,3,4,5,6-pentachlorophenoxy)carbonyloxyiminoacetate |
|---|---|
| PubChem CID | 88839635 |
| Molecular Formula | C12H5Cl5N2O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 431.86 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-(2,3,4,5,6-pentachlorophenoxy)carbonyloxyiminoacetate |
| SMILES | CCOC(=O)/C(C#N)=N\OC(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H5Cl5N2O5/c1-2-22-11(20)4(3-18)19-24-12(21)23-10-8(16)6(14)5(13)7(15)9(10)17/h2H2,1H3/b19-4- |
| InChIKey | CQKQVDHOEFRFBR-PVOVUMCXSA-N |
| XLogP | 4.91 |
| TPSA | 97.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|