About [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate
[(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate (PubChem CID 88659258) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate |
| PubChem CID | 88659258 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)O/N=C(\C#N)C(N)=O |
| InChI | InChI=1S/C8H11N3O4/c1-5(2)4-14-8(13)15-11-6(3-9)7(10)12/h5H,4H2,1-2H3,(H2,10,12)/b11-6+ |
| InChIKey | RBLQMAMPPCPBKT-IZZDOVSWSA-N |
| XLogP | 0.16 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate?
The IUPAC name of [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate (CID 88659258) is [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate.
What is the SMILES notation for [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate?
The canonical SMILES for [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate is CC(C)COC(=O)O/N=C(\C#N)C(N)=O.
What is the InChIKey of [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate?
The InChIKey is RBLQMAMPPCPBKT-IZZDOVSWSA-N. The full InChI is InChI=1S/C8H11N3O4/c1-5(2)4-14-8(13)15-11-6(3-9)7(10)12/h5H,4H2,1-2H3,(H2,10,12)/b11-6+.
What are the key properties of [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate?
[(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate has a molecular weight of 213.19 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2-amino-1-cyano-2-oxoethylidene)amino] 2-methylpropyl carbonate is sourced from PubChem (CID 88659258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).