About N'-(oxan-4-yl)-N'-propylbenzohydrazide
N'-(oxan-4-yl)-N'-propylbenzohydrazide (PubChem CID 140641753) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is N'-(oxan-4-yl)-N'-propylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(oxan-4-yl)-N'-propylbenzohydrazide |
| PubChem CID | 140641753 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N'-(oxan-4-yl)-N'-propylbenzohydrazide |
| SMILES | CCCN(NC(=O)c1ccccc1)C1CCOCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-10-17(14-8-11-19-12-9-14)16-15(18)13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3,(H,16,18) |
| InChIKey | XNVJRKHBRXOBRO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(oxan-4-yl)-N'-propylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(oxan-4-yl)-N'-propylbenzohydrazide?
The IUPAC name of N'-(oxan-4-yl)-N'-propylbenzohydrazide (CID 140641753) is N'-(oxan-4-yl)-N'-propylbenzohydrazide.
What is the SMILES notation for N'-(oxan-4-yl)-N'-propylbenzohydrazide?
The canonical SMILES for N'-(oxan-4-yl)-N'-propylbenzohydrazide is CCCN(NC(=O)c1ccccc1)C1CCOCC1.
What is the InChIKey of N'-(oxan-4-yl)-N'-propylbenzohydrazide?
The InChIKey is XNVJRKHBRXOBRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-2-10-17(14-8-11-19-12-9-14)16-15(18)13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3,(H,16,18).
What are the key properties of N'-(oxan-4-yl)-N'-propylbenzohydrazide?
N'-(oxan-4-yl)-N'-propylbenzohydrazide has a molecular weight of 262.35 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(oxan-4-yl)-N'-propylbenzohydrazide is sourced from PubChem (CID 140641753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).