C16H25N5O4S2 — CID 140643356
tert-butyl N-[(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethylsulfanyl]ethyl]carbamate (PubChem CID 140643356) has the molecular formula C16H25N5O4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 140643356 |
| Molecular Formula | C16H25N5O4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | tert-butyl N-[(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylsulfanylmethylsulfanyl]ethyl]carbamate |
| SMILES | Cc1noc(CCSCSC[C@H](NC(=O)OC(C)(C)C)c2nc(C)no2)n1 |
| InChI | InChI=1S/C16H25N5O4S2/c1-10-17-13(24-20-10)6-7-26-9-27-8-12(14-18-11(2)21-25-14)19-15(22)23-16(3,4)5/h12H,6-9H2,1-5H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | YSNWUGJIAXFKDI-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|