C17H22N2O3 — CID 163853824
tert-butyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)-4-phenylbutanoate (PubChem CID 163853824) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)-4-phenylbutanoate.
| Compound Name | tert-butyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)-4-phenylbutanoate |
|---|---|
| PubChem CID | 163853824 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | tert-butyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)-4-phenylbutanoate |
| SMILES | Cc1noc(C(CCC(=O)OC(C)(C)C)c2ccccc2)n1 |
| InChI | InChI=1S/C17H22N2O3/c1-12-18-16(22-19-12)14(13-8-6-5-7-9-13)10-11-15(20)21-17(2,3)4/h5-9,14H,10-11H2,1-4H3 |
| InChIKey | BROCCMUWAPCSTC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |