C19H27ClN2O4 — CID 140645530
tert-butyl 4-[(2-chloro-3-phenylpropanoyl)amino]-3-hydroxypiperidine-1-carboxylate (PubChem CID 140645530) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is tert-butyl 4-[(2-chloro-3-phenylpropanoyl)amino]-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-chloro-3-phenylpropanoyl)amino]-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 140645530 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | tert-butyl 4-[(2-chloro-3-phenylpropanoyl)amino]-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C(Cl)Cc2ccccc2)C(O)C1 |
| InChI | InChI=1S/C19H27ClN2O4/c1-19(2,3)26-18(25)22-10-9-15(16(23)12-22)21-17(24)14(20)11-13-7-5-4-6-8-13/h4-8,14-16,23H,9-12H2,1-3H3,(H,21,24) |
| InChIKey | WBDNMRPWIGMZAA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|