C45H39F5N2O9 — CID 140646535
(2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]ethyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 140646535) has the molecular formula C45H39F5N2O9 and a molecular weight of 846.80 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]ethyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]ethyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 140646535 |
| Molecular Formula | C45H39F5N2O9 |
| Molecular Weight | 846.80 g/mol |
| Exact Mass | 846.26 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[1-[6-[(2,4-dimethoxyphenyl)-diphenylmethoxy]hexoxycarbonylamino]ethyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(C(OCCCCCCOC(=O)NC(C)c2c(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc3c2C(=O)NC3=O)(c2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C45H39F5N2O9/c1-25(33-30(20-19-29-34(33)42(54)52-41(29)53)43(55)61-40-38(49)36(47)35(46)37(48)39(40)50)51-44(56)59-22-12-4-5-13-23-60-45(26-14-8-6-9-15-26,27-16-10-7-11-17-27)31-21-18-28(57-2)24-32(31)58-3/h6-11,14-21,24-25H,4-5,12-13,22-23H2,1-3H3,(H,51,56)(H,52,53,54) |
| InChIKey | SDLQIVGZBHCUNA-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.80 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|