C18H42N2OSi — CID 140647706
2-[(ethyl-hexyl-methoxysilyl)methyl]-N,N,N',N',2-pentamethylpropane-1,3-diamine (PubChem CID 140647706) has the molecular formula C18H42N2OSi and a molecular weight of 330.63 g/mol. Its IUPAC name is 2-[(ethyl-hexyl-methoxysilyl)methyl]-N,N,N',N',2-pentamethylpropane-1,3-diamine.
| Compound Name | 2-[(ethyl-hexyl-methoxysilyl)methyl]-N,N,N',N',2-pentamethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 140647706 |
| Molecular Formula | C18H42N2OSi |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | 2-[(ethyl-hexyl-methoxysilyl)methyl]-N,N,N',N',2-pentamethylpropane-1,3-diamine |
| SMILES | CCCCCC[Si](CC)(CC(C)(CN(C)C)CN(C)C)OC |
| InChI | InChI=1S/C18H42N2OSi/c1-9-11-12-13-14-22(10-2,21-8)17-18(3,15-19(4)5)16-20(6)7/h9-17H2,1-8H3 |
| InChIKey | CBDUGKIMLXICBB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|