C21H29N3O5S — CID 140648063
(2R)-N-[(2S)-1-anilino-7-ethoxycarbothioyloxy-1-oxoheptan-2-yl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 140648063) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-anilino-7-ethoxycarbothioyloxy-1-oxoheptan-2-yl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(2S)-1-anilino-7-ethoxycarbothioyloxy-1-oxoheptan-2-yl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140648063 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (2R)-N-[(2S)-1-anilino-7-ethoxycarbothioyloxy-1-oxoheptan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CCOC(=S)OCCCCC[C@H](NC(=O)[C@H]1CCC(=O)N1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-2-28-21(30)29-14-8-4-7-11-16(19(26)22-15-9-5-3-6-10-15)24-20(27)17-12-13-18(25)23-17/h3,5-6,9-10,16-17H,2,4,7-8,11-14H2,1H3,(H,22,26)(H,23,25)(H,24,27)/t16-,17+/m0/s1 |
| InChIKey | AMOCDUAYMXFIHU-DLBZAZTESA-N |
| XLogP | 2.29 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|