C12H20O2 — CID 140649409
(1S,2S,5S)-5-methyl-2-(2-methyl-1-oxopropan-2-yl)cyclohexane-1-carbaldehyde (PubChem CID 140649409) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1S,2S,5S)-5-methyl-2-(2-methyl-1-oxopropan-2-yl)cyclohexane-1-carbaldehyde.
| Compound Name | (1S,2S,5S)-5-methyl-2-(2-methyl-1-oxopropan-2-yl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 140649409 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1S,2S,5S)-5-methyl-2-(2-methyl-1-oxopropan-2-yl)cyclohexane-1-carbaldehyde |
| SMILES | C[C@H]1CC[C@H](C(C)(C)C=O)[C@@H](C=O)C1 |
| InChI | InChI=1S/C12H20O2/c1-9-4-5-11(10(6-9)7-13)12(2,3)8-14/h7-11H,4-6H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | GRZWLKLUMXNQOW-AXFHLTTASA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|