C10H10NaO5- — CID 140651607
sodium;dimethyl benzene-5-ide-1,2-dicarboxylate;hydroxide (PubChem CID 140651607) has the molecular formula C10H10NaO5- and a molecular weight of 233.17 g/mol. Its IUPAC name is sodium;dimethyl benzene-5-ide-1,2-dicarboxylate;hydroxide.
| Compound Name | sodium;dimethyl benzene-5-ide-1,2-dicarboxylate;hydroxide |
|---|---|
| PubChem CID | 140651607 |
| Molecular Formula | C10H10NaO5- |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | sodium;dimethyl benzene-5-ide-1,2-dicarboxylate;hydroxide |
| SMILES | COC(=O)c1c[c-]ccc1C(=O)OC.[Na+].[OH-] |
| InChI | InChI=1S/C10H9O4.Na.H2O/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2;;/h3,5-6H,1-2H3;;1H2/q-1;+1;/p-1 |
| InChIKey | HGMXRXNKIUTBOP-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 82.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|