About zinc methyl benzoate
zinc methyl benzoate (PubChem CID 15977761) has the molecular formula C16H14O4Zn
and a molecular weight of 335.67 g/mol. Its IUPAC name is zinc methyl benzoate.
Molecular Properties
| Compound Name | zinc methyl benzoate |
| PubChem CID | 15977761 |
| Molecular Formula | C16H14O4Zn |
| Molecular Weight | 335.67 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | zinc methyl benzoate |
| SMILES | COC(=O)c1c[c-]ccc1.COC(=O)c1c[c-]ccc1.[Zn+2] |
| InChI | InChI=1S/2C8H7O2.Zn/c2*1-10-8(9)7-5-3-2-4-6-7;/h2*2-3,5-6H,1H3;/q2*-1;+2 |
| InChIKey | WEQJGINLRDONRY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.67 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc methyl benzoate?
The IUPAC name of zinc methyl benzoate (CID 15977761) is zinc methyl benzoate.
What is the SMILES notation for zinc methyl benzoate?
The canonical SMILES for zinc methyl benzoate is COC(=O)c1c[c-]ccc1.COC(=O)c1c[c-]ccc1.[Zn+2].
What is the InChIKey of zinc methyl benzoate?
The InChIKey is WEQJGINLRDONRY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7O2.Zn/c2*1-10-8(9)7-5-3-2-4-6-7;/h2*2-3,5-6H,1H3;/q2*-1;+2.
What are the key properties of zinc methyl benzoate?
zinc methyl benzoate has a molecular weight of 335.67 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc methyl benzoate is sourced from PubChem (CID 15977761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).