C44H40 — CID 140656633
(5Z,7Z,9Z,11Z)-12-[(1Z,3Z,5Z,7Z)-8-[(1Z,3Z,5Z,7E)-cyclodeca-1,3,5,7-tetraen-1-yl]cyclodeca-1,3,5,7-tetraen-1-yl]-5-naphthalen-1-yl-4a,12a-dihydrobenzo[10]annulene (PubChem CID 140656633) has the molecular formula C44H40 and a molecular weight of 568.80 g/mol. Its IUPAC name is (5Z,7Z,9Z,11Z)-12-[(1Z,3Z,5Z,7Z)-8-[(1Z,3Z,5Z,7E)-cyclodeca-1,3,5,7-tetraen-1-yl]cyclodeca-1,3,5,7-tetraen-1-yl]-5-naphthalen-1-yl-4a,12a-dihydrobenzo[10]annulene.
| Compound Name | (5Z,7Z,9Z,11Z)-12-[(1Z,3Z,5Z,7Z)-8-[(1Z,3Z,5Z,7E)-cyclodeca-1,3,5,7-tetraen-1-yl]cyclodeca-1,3,5,7-tetraen-1-yl]-5-naphthalen-1-yl-4a,12a-dihydrobenzo[10]annulene |
|---|---|
| PubChem CID | 140656633 |
| Molecular Formula | C44H40 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | (5Z,7Z,9Z,11Z)-12-[(1Z,3Z,5Z,7Z)-8-[(1Z,3Z,5Z,7E)-cyclodeca-1,3,5,7-tetraen-1-yl]cyclodeca-1,3,5,7-tetraen-1-yl]-5-naphthalen-1-yl-4a,12a-dihydrobenzo[10]annulene |
| SMILES | C1=CC2C(/C3=C\C=C/C=C\C=C(C4=C\C=C/C=C\C=C\CC/4)\CC3)=C/C=C\C=C/C=C(\c3cccc4ccccc34)C2C=C1 |
| InChI | InChI=1S/C44H40/c1-2-4-10-21-35(22-11-5-3-1)36-23-12-6-7-13-24-38(34-33-36)40-27-14-8-9-15-29-43(44-31-19-18-30-41(40)44)42-32-20-26-37-25-16-17-28-39(37)42/h1-10,12-21,23-32,41,44H,11,22,33-34H2/b2-1-,5-3+,10-4-,12-6-,13-7-,14-8-,15-9-,35-21-,36-23-,38-24-,40-27+,43-29+ |
| InChIKey | GYPSEAICIAAEKA-QECLGFBBSA-N |
| XLogP | 11.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |