C31H56F2N8O — CID 140656678
1,3-bis[2-fluoro-4-(2-piperazin-1-ylpiperidin-4-yl)cyclohexyl]urea (PubChem CID 140656678) has the molecular formula C31H56F2N8O and a molecular weight of 594.84 g/mol. Its IUPAC name is 1,3-bis[2-fluoro-4-(2-piperazin-1-ylpiperidin-4-yl)cyclohexyl]urea.
| Compound Name | 1,3-bis[2-fluoro-4-(2-piperazin-1-ylpiperidin-4-yl)cyclohexyl]urea |
|---|---|
| PubChem CID | 140656678 |
| Molecular Formula | C31H56F2N8O |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.45 |
| IUPAC Name | 1,3-bis[2-fluoro-4-(2-piperazin-1-ylpiperidin-4-yl)cyclohexyl]urea |
| SMILES | O=C(NC1CCC(C2CCNC(N3CCNCC3)C2)CC1F)NC1CCC(C2CCNC(N3CCNCC3)C2)CC1F |
| InChI | InChI=1S/C31H56F2N8O/c32-25-17-21(23-5-7-36-29(19-23)40-13-9-34-10-14-40)1-3-27(25)38-31(42)39-28-4-2-22(18-26(28)33)24-6-8-37-30(20-24)41-15-11-35-12-16-41/h21-30,34-37H,1-20H2,(H2,38,39,42) |
| InChIKey | RVAABHSGLJSTSC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |