C30H52F2N6O — CID 165078939
16,19-difluoro-22-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 165078939) has the molecular formula C30H52F2N6O and a molecular weight of 550.78 g/mol. Its IUPAC name is 16,19-difluoro-22-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 16,19-difluoro-22-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 165078939 |
| Molecular Formula | C30H52F2N6O |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | 16,19-difluoro-22-[(2S)-2-methylpiperidin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | CC(C)C1NCCC2CCCNC3CCCC(F)C3C3NC4C(CC3F)C(N3CCCC[C@@H]3C)NC(=O)N4C21 |
| InChI | InChI=1S/C30H52F2N6O/c1-17(2)25-27-19(12-14-34-25)9-7-13-33-23-11-6-10-21(31)24(23)26-22(32)16-20-28(37-15-5-4-8-18(37)3)36-30(39)38(27)29(20)35-26/h17-29,33-35H,4-16H2,1-3H3,(H,36,39)/t18-,19?,20?,21?,22?,23?,24?,25?,26?,27?,28?,29?/m0/s1 |
| InChIKey | QCRYOVLLUQTGPQ-GMWMAXRESA-N |
| XLogP | 3.75 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |