C33H55F2N7O2 — CID 164979883
16,19-difluoro-11-methyl-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 164979883) has the molecular formula C33H55F2N7O2 and a molecular weight of 619.85 g/mol. Its IUPAC name is 16,19-difluoro-11-methyl-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 16,19-difluoro-11-methyl-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 164979883 |
| Molecular Formula | C33H55F2N7O2 |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.44 |
| IUPAC Name | 16,19-difluoro-11-methyl-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | C=CC(=O)N1CCN(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2N(C)CCCC2CCNC(C(C)C)C23)[C@@H](C)C1 |
| InChI | InChI=1S/C33H55F2N7O2/c1-6-26(43)40-15-16-41(20(4)18-40)31-22-17-24(35)29-27-23(34)10-7-11-25(27)39(5)14-8-9-21-12-13-36-28(19(2)3)30(21)42(32(22)37-29)33(44)38-31/h6,19-25,27-32,36-37H,1,7-18H2,2-5H3,(H,38,44)/t20-,21?,22?,23?,24?,25?,27?,28?,29?,30?,31?,32?/m0/s1 |
| InChIKey | SPVNDIJJWREEGE-HCURTMIUSA-N |
| XLogP | 2.93 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|