C32H50F2N6O3 — CID 165019240
16,19-difluoro-3-propan-2-yl-22-[(1R,6S)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 165019240) has the molecular formula C32H50F2N6O3 and a molecular weight of 604.79 g/mol. Its IUPAC name is 16,19-difluoro-3-propan-2-yl-22-[(1R,6S)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 16,19-difluoro-3-propan-2-yl-22-[(1R,6S)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 165019240 |
| Molecular Formula | C32H50F2N6O3 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.39 |
| IUPAC Name | 16,19-difluoro-3-propan-2-yl-22-[(1R,6S)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | C=CC(=O)N1CCN(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2OCCCC2CCNC(C(C)C)C23)[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C32H50F2N6O3/c1-4-25(41)38-12-13-39(23-16-22(23)38)30-19-15-21(34)28-26-20(33)8-5-9-24(26)43-14-6-7-18-10-11-35-27(17(2)3)29(18)40(31(19)36-28)32(42)37-30/h4,17-24,26-31,35-36H,1,5-16H2,2-3H3,(H,37,42)/t18?,19?,20?,21?,22-,23+,24?,26?,27?,28?,29?,30?,31?/m0/s1 |
| InChIKey | QEOIHMULWVRSCR-QABZXJCHSA-N |
| XLogP | 2.77 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|