C34H55F2N7O2 — CID 165030248
22-[(3R,7S)-3,7-dimethyl-2-prop-2-enoyl-2,6-diazaspiro[3.3]heptan-6-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 165030248) has the molecular formula C34H55F2N7O2 and a molecular weight of 631.86 g/mol. Its IUPAC name is 22-[(3R,7S)-3,7-dimethyl-2-prop-2-enoyl-2,6-diazaspiro[3.3]heptan-6-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 22-[(3R,7S)-3,7-dimethyl-2-prop-2-enoyl-2,6-diazaspiro[3.3]heptan-6-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 165030248 |
| Molecular Formula | C34H55F2N7O2 |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.44 |
| IUPAC Name | 22-[(3R,7S)-3,7-dimethyl-2-prop-2-enoyl-2,6-diazaspiro[3.3]heptan-6-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | C=CC(=O)N1CC2(CN(C3NC(=O)N4C5NC(C(F)CC53)C3C(F)CCCC3NCCCC3CCNC(C(C)C)C34)[C@H]2C)[C@H]1C |
| InChI | InChI=1S/C34H55F2N7O2/c1-6-26(44)41-16-34(19(41)4)17-42(20(34)5)31-22-15-24(36)29-27-23(35)10-7-11-25(27)37-13-8-9-21-12-14-38-28(18(2)3)30(21)43(32(22)39-29)33(45)40-31/h6,18-25,27-32,37-39H,1,7-17H2,2-5H3,(H,40,45)/t19-,20+,21?,22?,23?,24?,25?,27?,28?,29?,30?,31?,32?,34?/m1/s1 |
| InChIKey | AHGJGOHMAUONBE-GLMACLAXSA-N |
| XLogP | 2.98 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|