C24H41F2N5O2 — CID 165075518
16,19-difluoro-22-hydroxy-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 165075518) has the molecular formula C24H41F2N5O2 and a molecular weight of 469.62 g/mol. Its IUPAC name is 16,19-difluoro-22-hydroxy-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 16,19-difluoro-22-hydroxy-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 165075518 |
| Molecular Formula | C24H41F2N5O2 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 16,19-difluoro-22-hydroxy-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | CC(C)C1NCCC2CCCNC3CCCC(F)C3C3NC4C(CC3F)C(O)NC(=O)N4C21 |
| InChI | InChI=1S/C24H41F2N5O2/c1-12(2)19-21-13(8-10-28-19)5-4-9-27-17-7-3-6-15(25)18(17)20-16(26)11-14-22(29-20)31(21)24(33)30-23(14)32/h12-23,27-29,32H,3-11H2,1-2H3,(H,30,33) |
| InChIKey | XAHBPJDULNZOMP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |