C28H32F2N4O3 — CID 140657906
(3R)-4-[3-butoxy-3-(4-fluorophenyl)azetidin-1-yl]-3-[(4-fluorophenyl)methyl]-2-(1H-imidazol-5-ylmethyl)-4-oxobutanamide (PubChem CID 140657906) has the molecular formula C28H32F2N4O3 and a molecular weight of 510.59 g/mol. Its IUPAC name is (3R)-4-[3-butoxy-3-(4-fluorophenyl)azetidin-1-yl]-3-[(4-fluorophenyl)methyl]-2-(1H-imidazol-5-ylmethyl)-4-oxobutanamide.
| Compound Name | (3R)-4-[3-butoxy-3-(4-fluorophenyl)azetidin-1-yl]-3-[(4-fluorophenyl)methyl]-2-(1H-imidazol-5-ylmethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 140657906 |
| Molecular Formula | C28H32F2N4O3 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (3R)-4-[3-butoxy-3-(4-fluorophenyl)azetidin-1-yl]-3-[(4-fluorophenyl)methyl]-2-(1H-imidazol-5-ylmethyl)-4-oxobutanamide |
| SMILES | CCCCOC1(c2ccc(F)cc2)CN(C(=O)[C@H](Cc2ccc(F)cc2)C(Cc2cnc[nH]2)C(N)=O)C1 |
| InChI | InChI=1S/C28H32F2N4O3/c1-2-3-12-37-28(20-6-10-22(30)11-7-20)16-34(17-28)27(36)25(13-19-4-8-21(29)9-5-19)24(26(31)35)14-23-15-32-18-33-23/h4-11,15,18,24-25H,2-3,12-14,16-17H2,1H3,(H2,31,35)(H,32,33)/t24?,25-/m1/s1 |
| InChIKey | WYPYWZSCDWQVMS-WUBHUQEYSA-N |
| XLogP | 3.75 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|