C30H37FN4O3 — CID 140657930
(3R)-4-[3-(5-fluoropentyl)-3-phenylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide (PubChem CID 140657930) has the molecular formula C30H37FN4O3 and a molecular weight of 520.65 g/mol. Its IUPAC name is (3R)-4-[3-(5-fluoropentyl)-3-phenylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide.
| Compound Name | (3R)-4-[3-(5-fluoropentyl)-3-phenylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 140657930 |
| Molecular Formula | C30H37FN4O3 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (3R)-4-[3-(5-fluoropentyl)-3-phenylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide |
| SMILES | COc1ccc(C[C@@H](C(=O)N2CC(CCCCCF)(c3ccccc3)C2)C(Cc2cnc[nH]2)C(N)=O)cc1 |
| InChI | InChI=1S/C30H37FN4O3/c1-38-25-12-10-22(11-13-25)16-27(26(28(32)36)17-24-18-33-21-34-24)29(37)35-19-30(20-35,14-6-3-7-15-31)23-8-4-2-5-9-23/h2,4-5,8-13,18,21,26-27H,3,6-7,14-17,19-20H2,1H3,(H2,32,36)(H,33,34)/t26?,27-/m1/s1 |
| InChIKey | UZGUKFCBRIIQJQ-SSYAZFEXSA-N |
| XLogP | 4.23 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|