C30H37ClN4O3 — CID 140657916
(3R)-4-[3-(2-chlorophenyl)-3-pentylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide (PubChem CID 140657916) has the molecular formula C30H37ClN4O3 and a molecular weight of 537.10 g/mol. Its IUPAC name is (3R)-4-[3-(2-chlorophenyl)-3-pentylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide.
| Compound Name | (3R)-4-[3-(2-chlorophenyl)-3-pentylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 140657916 |
| Molecular Formula | C30H37ClN4O3 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (3R)-4-[3-(2-chlorophenyl)-3-pentylazetidin-1-yl]-2-(1H-imidazol-5-ylmethyl)-3-[(4-methoxyphenyl)methyl]-4-oxobutanamide |
| SMILES | CCCCCC1(c2ccccc2Cl)CN(C(=O)[C@H](Cc2ccc(OC)cc2)C(Cc2cnc[nH]2)C(N)=O)C1 |
| InChI | InChI=1S/C30H37ClN4O3/c1-3-4-7-14-30(26-8-5-6-9-27(26)31)18-35(19-30)29(37)25(15-21-10-12-23(38-2)13-11-21)24(28(32)36)16-22-17-33-20-34-22/h5-6,8-13,17,20,24-25H,3-4,7,14-16,18-19H2,1-2H3,(H2,32,36)(H,33,34)/t24?,25-/m1/s1 |
| InChIKey | RJUPMLNJIXQFPP-WUBHUQEYSA-N |
| XLogP | 4.94 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|