C29H62O5Si3 — CID 140658612
ethyl (E,4S,5S,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enoate (PubChem CID 140658612) has the molecular formula C29H62O5Si3 and a molecular weight of 575.07 g/mol. Its IUPAC name is ethyl (E,4S,5S,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enoate.
| Compound Name | ethyl (E,4S,5S,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enoate |
|---|---|
| PubChem CID | 140658612 |
| Molecular Formula | C29H62O5Si3 |
| Molecular Weight | 575.07 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | ethyl (E,4S,5S,7R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H62O5Si3/c1-19-31-26(30)22(2)20-24(33-36(15,16)28(7,8)9)25(34-37(17,18)29(10,11)12)21-23(3)32-35(13,14)27(4,5)6/h20,23-25H,19,21H2,1-18H3/b22-20+/t23-,24+,25+/m1/s1 |
| InChIKey | YJNIOIIGZXFEEU-LYWJTSCNSA-N |
| XLogP | 9.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.07 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|