About 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide
5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide (PubChem CID 140658926) has the molecular formula C13H10N4O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide.
Molecular Properties
| Compound Name | 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide |
| PubChem CID | 140658926 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C=NCc1cncnc1-2 |
| InChI | InChI=1S/C13H10N4O/c14-13(18)8-1-2-11-9(3-8)4-15-5-10-6-16-7-17-12(10)11/h1-4,6-7H,5H2,(H2,14,18) |
| InChIKey | SVRYVXNHFDWBTP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide?
The IUPAC name of 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide (CID 140658926) is 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide.
What is the SMILES notation for 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide?
The canonical SMILES for 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide is NC(=O)c1ccc2c(c1)C=NCc1cncnc1-2.
What is the InChIKey of 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide?
The InChIKey is SVRYVXNHFDWBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O/c14-13(18)8-1-2-11-9(3-8)4-15-5-10-6-16-7-17-12(10)11/h1-4,6-7H,5H2,(H2,14,18).
What are the key properties of 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide?
5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide has a molecular weight of 238.25 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrimido[5,4-d][2]benzazepine-9-carboxamide is sourced from PubChem (CID 140658926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).