C8H8N4O — CID 175026609
1,4-dihydropyrido[3,2-d]pyrimidine-7-carboxamide (PubChem CID 175026609) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 1,4-dihydropyrido[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 1,4-dihydropyrido[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 175026609 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1,4-dihydropyrido[3,2-d]pyrimidine-7-carboxamide |
| SMILES | NC(=O)c1cnc2c(c1)NC=NC2 |
| InChI | InChI=1S/C8H8N4O/c9-8(13)5-1-6-7(11-2-5)3-10-4-12-6/h1-2,4H,3H2,(H2,9,13)(H,10,12) |
| InChIKey | GJVKZWLOASBGHG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |