C17H21FN2 — CID 140659149
N-tert-butyl-4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine (PubChem CID 140659149) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is N-tert-butyl-4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-tert-butyl-4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 140659149 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-tert-butyl-4-[(4-fluorophenyl)methylimino]cyclohexa-1,5-dien-1-amine |
| SMILES | CC(C)(C)NC1=CC/C(=N\Cc2ccc(F)cc2)C=C1 |
| InChI | InChI=1S/C17H21FN2/c1-17(2,3)20-16-10-8-15(9-11-16)19-12-13-4-6-14(18)7-5-13/h4-8,10-11,20H,9,12H2,1-3H3/b19-15- |
| InChIKey | RCCJUZCIUUSORX-CYVLTUHYSA-N |
| XLogP | 4.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|