C29H43FN4 — CID 89367342
(2Z,4Z,7E)-2-N-(1-aminoethenyl)-8-(3,3-dimethylbutan-2-ylideneamino)-2-N-(2,2-dimethylpropyl)-8-(4-fluorophenyl)-7-methyl-6-methylideneocta-2,4,7-triene-2,3-diamine (PubChem CID 89367342) has the molecular formula C29H43FN4 and a molecular weight of 466.69 g/mol. Its IUPAC name is (2Z,4Z,7E)-2-N-(1-aminoethenyl)-8-(3,3-dimethylbutan-2-ylideneamino)-2-N-(2,2-dimethylpropyl)-8-(4-fluorophenyl)-7-methyl-6-methylideneocta-2,4,7-triene-2,3-diamine.
| Compound Name | (2Z,4Z,7E)-2-N-(1-aminoethenyl)-8-(3,3-dimethylbutan-2-ylideneamino)-2-N-(2,2-dimethylpropyl)-8-(4-fluorophenyl)-7-methyl-6-methylideneocta-2,4,7-triene-2,3-diamine |
|---|---|
| PubChem CID | 89367342 |
| Molecular Formula | C29H43FN4 |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | (2Z,4Z,7E)-2-N-(1-aminoethenyl)-8-(3,3-dimethylbutan-2-ylideneamino)-2-N-(2,2-dimethylpropyl)-8-(4-fluorophenyl)-7-methyl-6-methylideneocta-2,4,7-triene-2,3-diamine |
| SMILES | C=C(/C=C\C(N)=C(/C)N(CC(C)(C)C)C(=C)N)/C(C)=C(/N=C(\C)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H43FN4/c1-19(12-17-26(32)21(3)34(23(5)31)18-28(6,7)8)20(2)27(33-22(4)29(9,10)11)24-13-15-25(30)16-14-24/h12-17H,1,5,18,31-32H2,2-4,6-11H3/b17-12-,26-21-,27-20+,33-22+ |
| InChIKey | ORFOBDYQPATPGU-UHEIYNEJSA-N |
| XLogP | 7.14 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|