C16H22N2O5 — CID 140659920
(2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl 4-(methylamino)-4-oxobutanoate (PubChem CID 140659920) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl 4-(methylamino)-4-oxobutanoate.
| Compound Name | (2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 140659920 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl 4-(methylamino)-4-oxobutanoate |
| SMILES | CNC(=O)CCC(=O)OCC1C=CC(C)C2C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C16H22N2O5/c1-9-4-5-10(8-23-12(20)7-6-11(19)17-2)14-13(9)15(21)18(3)16(14)22/h4-5,9-10,13-14H,6-8H2,1-3H3,(H,17,19) |
| InChIKey | POZWXWCMLWKHEU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|