C12H15NO4 — CID 54590195
[(3aR,4R,7S,7aS)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]methyl acetate (PubChem CID 54590195) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is [(3aR,4R,7S,7aS)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]methyl acetate.
| Compound Name | [(3aR,4R,7S,7aS)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 54590195 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [(3aR,4R,7S,7aS)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C=C[C@H](C)[C@@H]2C(=O)NC(=O)[C@@H]21 |
| InChI | InChI=1S/C12H15NO4/c1-6-3-4-8(5-17-7(2)14)10-9(6)11(15)13-12(10)16/h3-4,6,8-10H,5H2,1-2H3,(H,13,15,16)/t6-,8-,9-,10+/m0/s1 |
| InChIKey | JQJMHNSGLQYCHM-MIBSWOBISA-N |
| XLogP | 0.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|