C19H17ClN4O3S — CID 140661162
1-(benzenesulfonamido)-1-(2-chlorophenyl)-3-(pyridin-3-ylmethyl)urea (PubChem CID 140661162) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 1-(benzenesulfonamido)-1-(2-chlorophenyl)-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-(benzenesulfonamido)-1-(2-chlorophenyl)-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140661162 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 1-(benzenesulfonamido)-1-(2-chlorophenyl)-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)N(NS(=O)(=O)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN4O3S/c20-17-10-4-5-11-18(17)24(19(25)22-14-15-7-6-12-21-13-15)23-28(26,27)16-8-2-1-3-9-16/h1-13,23H,14H2,(H,22,25) |
| InChIKey | QEICBJJQWOUSCW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|