C21H25ClFN5O4S — CID 140663530
3-chloro-6-fluoro-N-methyl-4-[[3-(5-methyltetrazol-2-yl)-1-adamantyl]methoxy]-5-sulfonylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 140663530) has the molecular formula C21H25ClFN5O4S and a molecular weight of 497.98 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-methyl-4-[[3-(5-methyltetrazol-2-yl)-1-adamantyl]methoxy]-5-sulfonylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-methyl-4-[[3-(5-methyltetrazol-2-yl)-1-adamantyl]methoxy]-5-sulfonylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 140663530 |
| Molecular Formula | C21H25ClFN5O4S |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 3-chloro-6-fluoro-N-methyl-4-[[3-(5-methyltetrazol-2-yl)-1-adamantyl]methoxy]-5-sulfonylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CNC(=O)C1=CC(Cl)=C(OCC23CC4CC(C2)CC(n2nnc(C)n2)(C4)C3)C(=S(=O)=O)C1F |
| InChI | InChI=1S/C21H25ClFN5O4S/c1-11-25-27-28(26-11)21-7-12-3-13(8-21)6-20(5-12,9-21)10-32-17-15(22)4-14(19(29)24-2)16(23)18(17)33(30)31/h4,12-13,16H,3,5-10H2,1-2H3,(H,24,29) |
| InChIKey | DQJGVWSRILACQM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|