C19H23F2NO4S — CID 140683944
6-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methyl-5-sulfonylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 140683944) has the molecular formula C19H23F2NO4S and a molecular weight of 399.46 g/mol. Its IUPAC name is 6-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methyl-5-sulfonylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 6-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methyl-5-sulfonylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 140683944 |
| Molecular Formula | C19H23F2NO4S |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 6-fluoro-4-[(3-fluoro-1-adamantyl)methoxy]-N-methyl-5-sulfonylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CNC(=O)C1=CC=C(OCC23CC4CC(CC(F)(C4)C2)C3)C(=S(=O)=O)C1F |
| InChI | InChI=1S/C19H23F2NO4S/c1-22-17(23)13-2-3-14(16(15(13)20)27(24)25)26-10-18-5-11-4-12(6-18)8-19(21,7-11)9-18/h2-3,11-12,15H,4-10H2,1H3,(H,22,23) |
| InChIKey | ODZFNYSHOQTDNW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|