C15H22F2O6S — CID 167141191
1,1-difluoro-2-[[3-(methoxymethoxy)-1-adamantyl]methoxy]-2-oxoethanesulfinic acid (PubChem CID 167141191) has the molecular formula C15H22F2O6S and a molecular weight of 368.40 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-(methoxymethoxy)-1-adamantyl]methoxy]-2-oxoethanesulfinic acid.
| Compound Name | 1,1-difluoro-2-[[3-(methoxymethoxy)-1-adamantyl]methoxy]-2-oxoethanesulfinic acid |
|---|---|
| PubChem CID | 167141191 |
| Molecular Formula | C15H22F2O6S |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1,1-difluoro-2-[[3-(methoxymethoxy)-1-adamantyl]methoxy]-2-oxoethanesulfinic acid |
| SMILES | COCOC12CC3CC(CC(COC(=O)C(F)(F)S(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C15H22F2O6S/c1-21-9-23-14-5-10-2-11(6-14)4-13(3-10,7-14)8-22-12(18)15(16,17)24(19)20/h10-11H,2-9H2,1H3,(H,19,20) |
| InChIKey | MUKGQLLAUPRPGO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|