C12H14F2O4S — CID 123742418
1,1-difluoro-2-oxo-2-(1-tetracyclo[3.3.1.03,9.07,9]nonanylmethoxy)ethanesulfinic acid (PubChem CID 123742418) has the molecular formula C12H14F2O4S and a molecular weight of 292.30 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(1-tetracyclo[3.3.1.03,9.07,9]nonanylmethoxy)ethanesulfinic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-(1-tetracyclo[3.3.1.03,9.07,9]nonanylmethoxy)ethanesulfinic acid |
|---|---|
| PubChem CID | 123742418 |
| Molecular Formula | C12H14F2O4S |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(1-tetracyclo[3.3.1.03,9.07,9]nonanylmethoxy)ethanesulfinic acid |
| SMILES | O=C(OCC12CC3CC4CC(C1)C432)C(F)(F)S(=O)O |
| InChI | InChI=1S/C12H14F2O4S/c13-12(14,19(16)17)9(15)18-5-10-3-7-1-6-2-8(4-10)11(6,7)10/h6-8H,1-5H2,(H,16,17) |
| InChIKey | JCVRFFWAXONPOE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|