C10H11N2OY- — CID 140665183
2-(ethoxymethyl)pyrazolo[1,5-a]pyridine;yttrium (PubChem CID 140665183) has the molecular formula C10H11N2OY- and a molecular weight of 264.12 g/mol. Its IUPAC name is 2-(ethoxymethyl)pyrazolo[1,5-a]pyridine;yttrium.
| Compound Name | 2-(ethoxymethyl)pyrazolo[1,5-a]pyridine;yttrium |
|---|---|
| PubChem CID | 140665183 |
| Molecular Formula | C10H11N2OY- |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-(ethoxymethyl)pyrazolo[1,5-a]pyridine;yttrium |
| SMILES | [CH2-]COCc1cc2ccccn2n1.[Y] |
| InChI | InChI=1S/C10H11N2O.Y/c1-2-13-8-9-7-10-5-3-4-6-12(10)11-9;/h3-7H,1-2,8H2;/q-1; |
| InChIKey | DRZFPEALKJZGCT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|