C21H29N3O5 — CID 140665204
(11Z)-2-[4-(azepan-1-yl)butoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione (PubChem CID 140665204) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is (11Z)-2-[4-(azepan-1-yl)butoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione.
| Compound Name | (11Z)-2-[4-(azepan-1-yl)butoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione |
|---|---|
| PubChem CID | 140665204 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (11Z)-2-[4-(azepan-1-yl)butoxy]-9,14-dioxa-3,4-diazatricyclo[6.6.1.04,15]pentadeca-1(15),2,11-triene-10,13-dione |
| SMILES | O=C1/C=C\C(=O)OC2CCCn3nc(OCCCCN4CCCCCC4)c(c32)O1 |
| InChI | InChI=1S/C21H29N3O5/c25-17-9-10-18(26)29-20-19-16(28-17)8-7-14-24(19)22-21(20)27-15-6-5-13-23-11-3-1-2-4-12-23/h9-10,16H,1-8,11-15H2/b10-9- |
| InChIKey | DHIHQDCOQIFXAA-KTKRTIGZSA-N |
| XLogP | 2.77 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|