C13H17NOS — CID 14066551
2,2-dimethyl-5-methylsulfanyl-1-oxido-3-phenyl-3,4-dihydropyrrol-1-ium (PubChem CID 14066551) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 2,2-dimethyl-5-methylsulfanyl-1-oxido-3-phenyl-3,4-dihydropyrrol-1-ium.
| Compound Name | 2,2-dimethyl-5-methylsulfanyl-1-oxido-3-phenyl-3,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 14066551 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2,2-dimethyl-5-methylsulfanyl-1-oxido-3-phenyl-3,4-dihydropyrrol-1-ium |
| SMILES | CSC1=[N+]([O-])C(C)(C)C(c2ccccc2)C1 |
| InChI | InChI=1S/C13H17NOS/c1-13(2)11(9-12(16-3)14(13)15)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3 |
| InChIKey | LZGALDYNIGHMCH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|