C27H34ClN3O2 — CID 140666340
N-[1-[2-(3-chlorophenyl)-5-(3-piperidin-1-ylpropoxy)indol-1-yl]propan-2-yl]acetamide (PubChem CID 140666340) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is N-[1-[2-(3-chlorophenyl)-5-(3-piperidin-1-ylpropoxy)indol-1-yl]propan-2-yl]acetamide.
| Compound Name | N-[1-[2-(3-chlorophenyl)-5-(3-piperidin-1-ylpropoxy)indol-1-yl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 140666340 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-[1-[2-(3-chlorophenyl)-5-(3-piperidin-1-ylpropoxy)indol-1-yl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)Cn1c(-c2cccc(Cl)c2)cc2cc(OCCCN3CCCCC3)ccc21 |
| InChI | InChI=1S/C27H34ClN3O2/c1-20(29-21(2)32)19-31-26-11-10-25(33-15-7-14-30-12-4-3-5-13-30)17-23(26)18-27(31)22-8-6-9-24(28)16-22/h6,8-11,16-18,20H,3-5,7,12-15,19H2,1-2H3,(H,29,32) |
| InChIKey | LPPFIRFNRZCTRY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|