C27H34ClN3O3 — CID 140666405
N-[1-[2-(3-chlorophenyl)-5-[3-(3-hydroxypiperidin-1-yl)propoxy]indol-1-yl]propan-2-yl]acetamide (PubChem CID 140666405) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is N-[1-[2-(3-chlorophenyl)-5-[3-(3-hydroxypiperidin-1-yl)propoxy]indol-1-yl]propan-2-yl]acetamide.
| Compound Name | N-[1-[2-(3-chlorophenyl)-5-[3-(3-hydroxypiperidin-1-yl)propoxy]indol-1-yl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 140666405 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-[1-[2-(3-chlorophenyl)-5-[3-(3-hydroxypiperidin-1-yl)propoxy]indol-1-yl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)Cn1c(-c2cccc(Cl)c2)cc2cc(OCCCN3CCCC(O)C3)ccc21 |
| InChI | InChI=1S/C27H34ClN3O3/c1-19(29-20(2)32)17-31-26-10-9-25(34-13-5-12-30-11-4-8-24(33)18-30)15-22(26)16-27(31)21-6-3-7-23(28)14-21/h3,6-7,9-10,14-16,19,24,33H,4-5,8,11-13,17-18H2,1-2H3,(H,29,32) |
| InChIKey | JPYBMNMTMUQTKU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|