C28H33ClN2O3 — CID 159485846
1-[2-(3-chlorophenyl)-5-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]indol-1-yl]-4-methylpentan-2-one (PubChem CID 159485846) has the molecular formula C28H33ClN2O3 and a molecular weight of 481.04 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-5-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]indol-1-yl]-4-methylpentan-2-one.
| Compound Name | 1-[2-(3-chlorophenyl)-5-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]indol-1-yl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 159485846 |
| Molecular Formula | C28H33ClN2O3 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-5-[3-(2-oxa-6-azaspiro[3.3]heptan-6-yl)propoxy]indol-1-yl]-4-methylpentan-2-one |
| SMILES | CC(C)CC(=O)Cn1c(-c2cccc(Cl)c2)cc2cc(OCCCN3CC4(COC4)C3)ccc21 |
| InChI | InChI=1S/C28H33ClN2O3/c1-20(2)11-24(32)15-31-26-8-7-25(34-10-4-9-30-16-28(17-30)18-33-19-28)13-22(26)14-27(31)21-5-3-6-23(29)12-21/h3,5-8,12-14,20H,4,9-11,15-19H2,1-2H3 |
| InChIKey | LXOJYPAJARHALN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|