C24H27ClFNO3 — CID 149282514
1-[5-(3-chloropropoxy)-2-(4-fluoro-3-methoxyphenyl)indol-1-yl]-4-methylpentan-2-one (PubChem CID 149282514) has the molecular formula C24H27ClFNO3 and a molecular weight of 431.94 g/mol. Its IUPAC name is 1-[5-(3-chloropropoxy)-2-(4-fluoro-3-methoxyphenyl)indol-1-yl]-4-methylpentan-2-one.
| Compound Name | 1-[5-(3-chloropropoxy)-2-(4-fluoro-3-methoxyphenyl)indol-1-yl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 149282514 |
| Molecular Formula | C24H27ClFNO3 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[5-(3-chloropropoxy)-2-(4-fluoro-3-methoxyphenyl)indol-1-yl]-4-methylpentan-2-one |
| SMILES | COc1cc(-c2cc3cc(OCCCCl)ccc3n2CC(=O)CC(C)C)ccc1F |
| InChI | InChI=1S/C24H27ClFNO3/c1-16(2)11-19(28)15-27-22-8-6-20(30-10-4-9-25)12-18(22)13-23(27)17-5-7-21(26)24(14-17)29-3/h5-8,12-14,16H,4,9-11,15H2,1-3H3 |
| InChIKey | XTFRHAJSYKCAAU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|