C32H62N2P2Si2 — CID 140667826
ditert-butyl-[[2-[phosphanyl-di(piperidin-2-yl)methyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane (PubChem CID 140667826) has the molecular formula C32H62N2P2Si2 and a molecular weight of 592.98 g/mol. Its IUPAC name is ditert-butyl-[[2-[phosphanyl-di(piperidin-2-yl)methyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[2-[phosphanyl-di(piperidin-2-yl)methyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 140667826 |
| Molecular Formula | C32H62N2P2Si2 |
| Molecular Weight | 592.98 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | ditert-butyl-[[2-[phosphanyl-di(piperidin-2-yl)methyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane |
| SMILES | CC(C)(C)P(Cc1cc([Si](C)(C)C)c([Si](C)(C)C)cc1C(P)(C1CCCCN1)C1CCCCN1)C(C)(C)C |
| InChI | InChI=1S/C32H62N2P2Si2/c1-30(2,3)36(31(4,5)6)23-24-21-26(37(7,8)9)27(38(10,11)12)22-25(24)32(35,28-17-13-15-19-33-28)29-18-14-16-20-34-29/h21-22,28-29,33-34H,13-20,23,35H2,1-12H3 |
| InChIKey | ZUHZXMYYIQTCAK-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.98 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|