C42H72N4P2Si2 — CID 140667851
bis(1-adamantyl)-[[2-[bis(1,3-diazinan-2-yl)-phosphanylmethyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane (PubChem CID 140667851) has the molecular formula C42H72N4P2Si2 and a molecular weight of 751.19 g/mol. Its IUPAC name is bis(1-adamantyl)-[[2-[bis(1,3-diazinan-2-yl)-phosphanylmethyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[2-[bis(1,3-diazinan-2-yl)-phosphanylmethyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 140667851 |
| Molecular Formula | C42H72N4P2Si2 |
| Molecular Weight | 751.19 g/mol |
| Exact Mass | 750.48 |
| IUPAC Name | bis(1-adamantyl)-[[2-[bis(1,3-diazinan-2-yl)-phosphanylmethyl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane |
| SMILES | C[Si](C)(C)c1cc(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)c(C(P)(C2NCCCN2)C2NCCCN2)cc1[Si](C)(C)C |
| InChI | InChI=1S/C42H72N4P2Si2/c1-49(2,3)36-19-34(35(20-37(36)50(4,5)6)42(47,38-43-9-7-10-44-38)39-45-11-8-12-46-39)27-48(40-21-28-13-29(22-40)15-30(14-28)23-40)41-24-31-16-32(25-41)18-33(17-31)26-41/h19-20,28-33,38-39,43-46H,7-18,21-27,47H2,1-6H3 |
| InChIKey | YSRUOJBBHNTNGY-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.19 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|