C50H68P2 — CID 87315189
bis(1-adamantyl)-[[2-[bis(2-methylphenyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane (PubChem CID 87315189) has the molecular formula C50H68P2 and a molecular weight of 731.04 g/mol. Its IUPAC name is bis(1-adamantyl)-[[2-[bis(2-methylphenyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[2-[bis(2-methylphenyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane |
|---|---|
| PubChem CID | 87315189 |
| Molecular Formula | C50H68P2 |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.48 |
| IUPAC Name | bis(1-adamantyl)-[[2-[bis(2-methylphenyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane |
| SMILES | Cc1ccccc1P(Cc1cc(C(C)(C)C)c(C(C)(C)C)cc1CP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2)c1ccccc1C |
| InChI | InChI=1S/C50H68P2/c1-33-13-9-11-15-45(33)51(46-16-12-10-14-34(46)2)31-41-23-43(47(3,4)5)44(48(6,7)8)24-42(41)32-52(49-25-35-17-36(26-49)19-37(18-35)27-49)50-28-38-20-39(29-50)22-40(21-38)30-50/h9-16,23-24,35-40H,17-22,25-32H2,1-8H3 |
| InChIKey | ZFDNDGCHMAFNJZ-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|