C56H84P2 — CID 87463484
bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane (PubChem CID 87463484) has the molecular formula C56H84P2 and a molecular weight of 819.24 g/mol. Its IUPAC name is bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane |
|---|---|
| PubChem CID | 87463484 |
| Molecular Formula | C56H84P2 |
| Molecular Weight | 819.24 g/mol |
| Exact Mass | 818.60 |
| IUPAC Name | bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-ditert-butylphenyl]methyl]phosphane |
| SMILES | CC(C)(C)c1cc(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)c(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)cc1C(C)(C)C |
| InChI | InChI=1S/C56H84P2/c1-51(2,3)49-19-47(33-57(53-21-35-7-36(22-53)9-37(8-35)23-53)54-24-38-10-39(25-54)12-40(11-38)26-54)48(20-50(49)52(4,5)6)34-58(55-27-41-13-42(28-55)15-43(14-41)29-55)56-30-44-16-45(31-56)18-46(17-44)32-56/h19-20,35-46H,7-18,21-34H2,1-6H3 |
| InChIKey | MENHHHOLKGONOV-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.24 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|