C35H56P2 — CID 157306654
bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane (PubChem CID 157306654) has the molecular formula C35H56P2 and a molecular weight of 538.78 g/mol. Its IUPAC name is bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 157306654 |
| Molecular Formula | C35H56P2 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane |
| SMILES | CC(C)(C)P(CC1=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C=CC1)C(C)(C)C |
| InChI | InChI=1S/C35H56P2/c1-32(2,3)36(33(4,5)6)22-30-8-7-9-31(30)23-37(34-16-24-10-25(17-34)12-26(11-24)18-34)35-19-27-13-28(20-35)15-29(14-27)21-35/h7,9,24-29H,8,10-23H2,1-6H3 |
| InChIKey | FJYLIWQGVWWZKH-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|