C39H64N4P2 — CID 161237191
bis(1-adamantyl)-[[4-tert-butyl-2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane (PubChem CID 161237191) has the molecular formula C39H64N4P2 and a molecular weight of 650.92 g/mol. Its IUPAC name is bis(1-adamantyl)-[[4-tert-butyl-2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[4-tert-butyl-2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 161237191 |
| Molecular Formula | C39H64N4P2 |
| Molecular Weight | 650.92 g/mol |
| Exact Mass | 650.46 |
| IUPAC Name | bis(1-adamantyl)-[[4-tert-butyl-2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane |
| SMILES | CC(C)(C)C1=CC(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=C(C(P)(C2CNCCN2)C2CNCCN2)C1 |
| InChI | InChI=1S/C39H64N4P2/c1-36(2,3)32-14-31(33(15-32)39(44,34-22-40-4-6-42-34)35-23-41-5-7-43-35)24-45(37-16-25-8-26(17-37)10-27(9-25)18-37)38-19-28-11-29(20-38)13-30(12-28)21-38/h14,25-30,34-35,40-43H,4-13,15-24,44H2,1-3H3 |
| InChIKey | GJOYPGCKKZGXGU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.92 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|