C44H62N2P2 — CID 140667827
bis(1-adamantyl)-[[4,5-ditert-butyl-2-[phosphanyl-bis(1H-pyrrol-2-yl)methyl]phenyl]methyl]phosphane (PubChem CID 140667827) has the molecular formula C44H62N2P2 and a molecular weight of 680.94 g/mol. Its IUPAC name is bis(1-adamantyl)-[[4,5-ditert-butyl-2-[phosphanyl-bis(1H-pyrrol-2-yl)methyl]phenyl]methyl]phosphane.
| Compound Name | bis(1-adamantyl)-[[4,5-ditert-butyl-2-[phosphanyl-bis(1H-pyrrol-2-yl)methyl]phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 140667827 |
| Molecular Formula | C44H62N2P2 |
| Molecular Weight | 680.94 g/mol |
| Exact Mass | 680.44 |
| IUPAC Name | bis(1-adamantyl)-[[4,5-ditert-butyl-2-[phosphanyl-bis(1H-pyrrol-2-yl)methyl]phenyl]methyl]phosphane |
| SMILES | CC(C)(C)c1cc(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)c(C(P)(c2ccc[nH]2)c2ccc[nH]2)cc1C(C)(C)C |
| InChI | InChI=1S/C44H62N2P2/c1-40(2,3)36-19-34(35(20-37(36)41(4,5)6)44(47,38-9-7-11-45-38)39-10-8-12-46-39)27-48(42-21-28-13-29(22-42)15-30(14-28)23-42)43-24-31-16-32(25-43)18-33(17-31)26-43/h7-12,19-20,28-33,45-46H,13-18,21-27,47H2,1-6H3 |
| InChIKey | MZWZIRPVIIGODY-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.94 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|