C64H80FeP2 — CID 162128924
bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-3,4-diphenylcyclopenta-1,4-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+) (PubChem CID 162128924) has the molecular formula C64H80FeP2 and a molecular weight of 967.14 g/mol. Its IUPAC name is bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-3,4-diphenylcyclopenta-1,4-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+).
| Compound Name | bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-3,4-diphenylcyclopenta-1,4-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 162128924 |
| Molecular Formula | C64H80FeP2 |
| Molecular Weight | 967.14 g/mol |
| Exact Mass | 966.51 |
| IUPAC Name | bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-3,4-diphenylcyclopenta-1,4-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+) |
| SMILES | [Fe+2].c1cc[cH-]c1.c1ccc(-c2cc(CP(C34CC5CC(CC(C5)C3)C4)C34CC5CC(CC(C5)C3)C4)c(CP(C34CC5CC(CC(C5)C3)C4)C34CC5CC(CC(C5)C3)C4)[c-]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C59H75P2.C5H5.Fe/c1-3-7-50(8-4-1)53-23-52(36-60(56-24-38-11-39(25-56)13-40(12-38)26-56)57-27-41-14-42(28-57)16-43(15-41)29-57)54(55(53)51-9-5-2-6-10-51)37-61(58-30-44-17-45(31-58)19-46(18-44)32-58)59-33-47-20-48(34-59)22-49(21-47)35-59;1-2-4-5-3-1;/h1-10,23,38-49H,11-22,24-37H2;1-5H;/q2*-1;+2 |
| InChIKey | ZIKHDOLERGJDEU-UHFFFAOYSA-N |
| XLogP | 17.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.14 |
| LogP ≤ 5 | 17.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|